Galactose
Galactose (from the Greek stem γάλακτ– galakt–, "milk") is a sugar. It has almost the same chemical structure as glucose.
| Identifiers | |
|---|---|
| CAS number | |
| PubChem | |
| KEGG | D04291 |
| MeSH | |
| ChEBI | CHEBI:28061 |
| SMILES | O[C@H]1[C@@H](O)[C@H](O[C@H](O)[C@@H]1O)CO |
| Properties | |
| Molecular formula | C6H12O6 |
| Molar mass | 180.12 g mol-1 |
| Appearance | White solid[1] |
| Odor | Odorless[1] |
| Density | 1.5 g/cm3[1] |
| Melting point |
168-170 °C, 271 K, -106 °F |
| Solubility in water | 650 g/L (20 °C)[1] |
| -103.00·10−6 cm3/mol | |
| Pharmacology | |
| ATC code | |
| Hazards | |
| NFPA 704 |
|
Large amounts of pure galactose do not exist in nature. Instead, galactose is usually found with glucose in lactose, a sugar found in milk and other milk products. After lactose is digested and absorbed, galactose arrives in the liver. There it is changed into either glucose or glycogen.
Galactose Media
References
±