Zinc nitrate
Zinc nitrate is a chemical compound. Its chemical formula is Zn(NO3)2. It contains zinc and nitrate ions.
| Names | |
|---|---|
| IUPAC name
Zinc nitrate
| |
| Other names
Zinc dinitrate
| |
| Identifiers | |
| CAS number | |
| PubChem | |
| EC number | 231-943-8 |
| RTECS number | ZH4772000 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Zn+2] |
| Properties | |
| Molecular formula | Zn(NO3)2 |
| Molar mass | 189.36 g/mol (anhydrous) 297.49 g/mol (hexahydrate) |
| Appearance | colorless, deliquescent crystals |
| Density | 2.065 g/cm3 (hexahydrate) |
| Melting point |
110 °C, 383 K, 230 °F |
| Boiling point | |
| Solubility in water | 327 g/100 mL, 40 °C (trihydrate) 184.3 g/100 mL, 20 °C (hexahydrate) |
| Solubility | very soluble in alcohol |
| −63.0·10−6 cm3/mol | |
| Hazards | |
| Main hazards | Oxidant, may explode on heating |
| Flash point | Non-flammable |
| Related compounds | |
| Other anions | Zinc sulfate Zinc chloride |
| Other cations | Cadmium nitrate Mercury(II) nitrate |
Properties
Zinc nitrate is a colorless solid. It dissolves in water. It reacts with bases to make zinc hydroxide. It reacts with sodium carbonate to make zinc carbonate.
Preparation
It can be made by reacting zinc metal or zinc oxide with nitric acid.
Uses
It can be used as a mordant. It is also used as a source of zinc ions.