Cortisone
Cortisone is a 21-carbon steroid hormone. Its chemical name is 17-hydroxy-11-dehydrocorticosterone. It is one of the main hormones released by the adrenal gland in response to stress.
| Cortisone | |
|---|---|
| 200px | |
| 200px | |
| IUPAC name | (8S,9S,10R,13S,14S,17R)-17-Hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione |
| Other names | 17α,21-Dihydroxypregn-4-ene-3,11,20-trione; 17α,21-Dihydroxy-11-ketoprogesterone; 17α-Hydroxy-11-dehydrocorticosterone |
| Identifiers | |
| CAS number | |
| PubChem | |
| KEGG | D07749 |
| MeSH | |
| ChEBI | CHEBI:16962 |
| SMILES | O=C(CO)[C@@]3(O)CC[C@H]2[C@@H]4CC\C1=C\C(=O)CC[C@]1(C)[C@H]4C(=O)C[C@@]23C |
| Properties | |
| Molecular formula | C21H28O5 |
| Molar mass | 360.42 g mol-1 |
| Melting point |
220 to 224 °C, Expression error: Unrecognized word "to". K, Expression error: Unrecognized word "to". °F |
| Pharmacology | |
| ATC code | |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
In chemical structure, it is closely related to cortisol. It is used to treat a variety of ailments and can be administered in various ways. Cortisone suppresses the immune system. This reduces inflammation, pain and swelling at the site of the injury. Long-term use of cortisone has risks.[1][2]
Tadeus Reichstein, E.C. Kendall and P.S. Hench were awarded the Nobel Prize in Physiology or Medicine in 1950, for their discovery of cortisone.
References
- ↑ "Cortisone shots". MayoClinic.com. 2010-11-16. Retrieved July 31, 2013.
- ↑ "Prednisone and other corticosteroids: Balance the risks and benefits". MayoClinic.com. 2010-06-05. Retrieved 2011-09-03.