Changes

2,744 bytes added ,  10:00, 5 November 2014
{{Drugbox| Watchedfields = changed
| verifiedrevid = 477164519
| IUPAC_name = 8-chloro-1-methyl-6-phenyl-4''H''-<br />[1,2,4]triazolo[4,3-a][1,4]benzodiazepine
| image = Alprazolam.svg
| width = 200
| image2 = Alprazolam3Dan.gif
| width2 = 250

<!--Clinical data-->
| tradename = Xanax
| Drugs.com = {{drugs.com|monograph|alprazolam}}
| MedlinePlus = a684001
| pregnancy_US = D
| legal_UK = POM
| legal_US = Schedule IV
| dependency_liability = High
| routes_of_administration = Oral, Sublingual
<!--Pharmacokinetic data-->
| bioavailability = 80–90%
| metabolism = [[Liver|Hepatic]], via [[Cytochrome P450 3A4]]
| elimination_half-life = ''Immediate release:'' 11.2 hours,<ref>{{cite web |url=http://www.rxlist.com/xanax-drug.htm#cp |title=Xanax (Alprazolam) Clinical Pharmacology – Prescription Drugs and Medications |author=First DataBank |year=2008 |month=July |publisher=RxList}}</ref><br/>''Extended release:'' 10.7–15.8 hours<ref>{{cite web |url=http://www.rxlist.com/xanax-xr-drug.htm#cp |title=Xanax XR (Alprazolam) Clinical Pharmacology – Prescription Drugs and Medications |author=First DataBank |year=2008 |month=July |publisher=RxList}}</ref>
| excretion = [[Kidney|Renal]]

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 28981-97-7
| ATC_prefix = N05
| ATC_suffix = BA12
| PubChem = 2118
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00404
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2034
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = YU55MQ3IZY
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00225
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 2611
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 661

<!--Chemical data-->
| C=17 | H=13 | Cl=1 | N=4
| molecular_weight = 308.765
| smiles = ClC1=CC2=C(C=C1)N3C(C)=NN=C3CN=C2C4=CC=CC=C4
| InChI = 1/C17H13ClN4/c1-11-20-21-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)22(11)16/h2-9H,10H2,1H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H13ClN4/c1-11-20-21-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)22(11)16/h2-9H,10H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VREFGVBLTWBCJP-UHFFFAOYSA-N
}}
'''Alprazolam''' probably better known by its trade name, '''Xanax''' is a short-acting drug. The drug is used to treat people with [[anxiety]] disorders and [[panic attack]]s. Alprazolam is the most commonly misused benzodiazepine (the drug's class) in the [[United States]]; but the majority of prescribed users do not develop a substance use disorder. Alprazolam is a prescription drug in the United States.

==Sources==
{{reflist}}

{{med-stub}}

[[Category:Drugs]]
{{Link GA|en}}
Anonymous user