768,397
edits
Changes
mLine 1:
Line 1: − + + − + − + − + − + − | width2 = 250 − + + − + + + + + + − | routes_of_administration = Oral, Sublingual+ − + − + − + − + + + + + + − + Line 43:
Line 54: − + − | molecular_weight = 308.765 − | InChI = 1/C17H13ClN4/c1-11-20-21-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)22(11)16/h2-9H,10H2,1H3 + + + + + + + + − + Line 60:
Line 77: − {{Link GA|en}}
KS update 1.1
{{Drugbox| Watchedfields = changed
{{Infobox drug
| Watchedfields = changed
| verifiedrevid = 477164519
| verifiedrevid = 477164519
| IUPAC_name = 8-chloro-1-methyl-6-phenyl-4''H''-<br />[1,2,4]triazolo[4,3-a][1,4]benzodiazepine
| IUPAC_name = 8-Chloro-1-methyl-6-phenyl-4''H''-[1,2,4]triazolo[4,3-a] [1,4]benzodiazepine
| image = Alprazolam.svg
| image = Alprazolam structure.svg
| width = 200
| width = 140
| image2 = Alprazolam3Dan.gif
| image2 = Alprazolam ball-and-stick model.png
<!--Clinical data-->
<!--Clinical data-->
| tradename = Xanax
| tradename = Xanax, Xanor, Niravam, others
| Drugs.com = {{drugs.com|monograph|alprazolam}}
| Drugs.com = {{drugs.com|monograph|alprazolam}}
| pronounce = Alprazolam {{IPAc-en|æ|l|'|p|r|æ|z|ə|l|æ|m}} or {{IPAc-en|æ|l|'|p|r|eɪ|z|ə|l|æ|m}}, Xanax {{IPAc-en|'|z|æ|n|æ|k|s}}
| MedlinePlus = a684001
| MedlinePlus = a684001
| pregnancy_US = D
| pregnancy_US = D
| legal_UK = POM
| legal_AU = S8
| legal_CA = Schedule IV
| legal_UK = Class C
| legal_US = Schedule IV
| legal_US = Schedule IV
| legal_UN = Psychotropic Schedule IV
| legal_DE = Rx-only/Anlage III
| legal_status = Rx-only
| dependency_liability = High
| dependency_liability = High
<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability = 80–90%
| routes_of_administration = [[Oral administration|By mouth]]
| metabolism = [[Liver|Hepatic]], via [[Cytochrome P450 3A4]]
| protein_bound = 80%
| elimination_half-life = ''Immediate release:'' 11.2 hours,<ref>{{cite web |url=http://www.rxlist.com/xanax-drug.htm#cp |title=Xanax (Alprazolam) Clinical Pharmacology – Prescription Drugs and Medications |author=First DataBank |year=2008 |month=July |publisher=RxList}}</ref><br/>''Extended release:'' 10.7–15.8 hours<ref>{{cite web |url=http://www.rxlist.com/xanax-xr-drug.htm#cp |title=Xanax XR (Alprazolam) Clinical Pharmacology – Prescription Drugs and Medications |author=First DataBank |year=2008 |month=July |publisher=RxList}}</ref>
| bioavailability = 80–90%
| excretion = [[Kidney|Renal]]
| metabolism = [[Liver]], via [[cytochrome P450 3A4]]
| metabolites = alpha-hydroxyalprazolam, 4-hydroxyalprazolam, beta-hydroxyalprazolam
| onset = less than an hour<ref name=Lill2016>{{cite book |last1=Lilley |first1=Linda Lane |last2=Snyder |first2=Julie S. |last3=Collins |first3=Shelly Rainforth |title=Pharmacology for Canadian Health Care Practice |date=2016 |publisher=Elsevier Health Sciences |isbn=9781771720663 |page=329 |url=https://books.google.ca/books?id=dNgoDwAAQBAJ&pg=PA329 }}</ref>
|duration_of_action = 6 hours<ref name=Lill2016/>
| elimination_half-life = Immediate release: 4–6 hours<br />Extended release: 11–16 hours
| excretion = [[Kidney]]
<!--Identifiers-->
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| IUPHAR_ligand = 7111
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 28981-97-7
| CAS_number = 28981-97-7
<!--Chemical data-->
<!--Chemical data-->
| C=17 | H=13 | Cl=1 | N=4
| C = 17| H = 13| Cl = 1| N = 4
| smiles = ClC1=CC2=C(C=C1)N3C(C)=NN=C3CN=C2C4=CC=CC=C4
| smiles = ClC1=CC2=C(C=C1)N3C(C)=NN=C3CN=C2C4=CC=CC=C4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H13ClN4/c1-11-20-21-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)22(11)16/h2-9H,10H2,1H3
| StdInChI = 1S/C17H13ClN4/c1-11-20-21-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)22(11)16/h2-9H,10H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VREFGVBLTWBCJP-UHFFFAOYSA-N
| StdInChIKey = VREFGVBLTWBCJP-UHFFFAOYSA-N
| drug_name =
| alt =
| caption =
| type =
| licence_EU =
| pregnancy_AU =
| pregnancy_category =
| licence_US =
}}
}}
'''Alprazolam''' probably better known by its trade name, '''Xanax''' is a short-acting drug. The drug is used to treat people with [[anxiety]] disorders and [[panic attack]]s. Alprazolam is the most commonly misused benzodiazepine (the drug's class) in the [[United States]]; but the majority of prescribed users do not develop a substance use disorder. Alprazolam is a prescription drug in the United States.
'''Alprazolam''', probably better known by its trade name '''Xanax''', is a short-acting drug. The drug is used to treat people with [[anxiety]] disorders and [[panic attack]]s. Alprazolam is the most commonly misused [[benzodiazepine]] (the drug's class) in the [[United States]]; but the majority of prescribed users do not develop a substance-use disorder. Alprazolam is a prescription drug in the United States.
==Sources==
==Sources==
[[Category:Drugs]]
[[Category:Drugs]]